C9H13N4O6PS — CID 155549066
2-[2-(6-oxo-1H-purin-9-yl)ethylsulfonyl]ethylphosphonic acid (PubChem CID 155549066) has the molecular formula C9H13N4O6PS and a molecular weight of 336.27 g/mol. Its IUPAC name is 2-[2-(6-oxo-1H-purin-9-yl)ethylsulfonyl]ethylphosphonic acid.
| Compound Name | 2-[2-(6-oxo-1H-purin-9-yl)ethylsulfonyl]ethylphosphonic acid |
|---|---|
| PubChem CID | 155549066 |
| Molecular Formula | C9H13N4O6PS |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-[2-(6-oxo-1H-purin-9-yl)ethylsulfonyl]ethylphosphonic acid |
| SMILES | O=c1[nH]cnc2c1ncn2CCS(=O)(=O)CCP(=O)(O)O |
| InChI | InChI=1S/C9H13N4O6PS/c14-9-7-8(10-5-11-9)13(6-12-7)1-3-21(18,19)4-2-20(15,16)17/h5-6H,1-4H2,(H,10,11,14)(H2,15,16,17) |
| InChIKey | RXPHTFFMSIKZNT-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|