C9H11N4O6PS-2 — CID 172638065
9-[3-(phosphonatomethylsulfonyl)propyl]-1H-purin-6-one (PubChem CID 172638065) has the molecular formula C9H11N4O6PS-2 and a molecular weight of 334.25 g/mol. Its IUPAC name is 9-[3-(phosphonatomethylsulfonyl)propyl]-1H-purin-6-one.
| Compound Name | 9-[3-(phosphonatomethylsulfonyl)propyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 172638065 |
| Molecular Formula | C9H11N4O6PS-2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 9-[3-(phosphonatomethylsulfonyl)propyl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2CCCS(=O)(=O)CP(=O)([O-])[O-] |
| InChI | InChI=1S/C9H13N4O6PS/c14-9-7-8(10-4-11-9)13(5-12-7)2-1-3-21(18,19)6-20(15,16)17/h4-5H,1-3,6H2,(H,10,11,14)(H2,15,16,17)/p-2 |
| InChIKey | KTJPYEJQAZKZTH-UHFFFAOYSA-L |
| XLogP | -2.20 |
| TPSA | 160.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|