C13H13N4O5P — CID 135936877
[4-[2-(6-oxo-1H-purin-9-yl)ethoxy]phenyl]phosphonic acid (PubChem CID 135936877) has the molecular formula C13H13N4O5P and a molecular weight of 336.24 g/mol. Its IUPAC name is [4-[2-(6-oxo-1H-purin-9-yl)ethoxy]phenyl]phosphonic acid.
| Compound Name | [4-[2-(6-oxo-1H-purin-9-yl)ethoxy]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 135936877 |
| Molecular Formula | C13H13N4O5P |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [4-[2-(6-oxo-1H-purin-9-yl)ethoxy]phenyl]phosphonic acid |
| SMILES | O=c1[nH]cnc2c1ncn2CCOc1ccc(P(=O)(O)O)cc1 |
| InChI | InChI=1S/C13H13N4O5P/c18-13-11-12(14-7-15-13)17(8-16-11)5-6-22-9-1-3-10(4-2-9)23(19,20)21/h1-4,7-8H,5-6H2,(H,14,15,18)(H2,19,20,21) |
| InChIKey | WGFWOVOGJBNPGQ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|