C12H21N5O8P2 — CID 135566949
2-[2-(6-oxo-1H-purin-9-yl)ethyl-(2-phosphonoethyl)amino]ethoxymethylphosphonic acid (PubChem CID 135566949) has the molecular formula C12H21N5O8P2 and a molecular weight of 425.28 g/mol. Its IUPAC name is 2-[2-(6-oxo-1H-purin-9-yl)ethyl-(2-phosphonoethyl)amino]ethoxymethylphosphonic acid.
| Compound Name | 2-[2-(6-oxo-1H-purin-9-yl)ethyl-(2-phosphonoethyl)amino]ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 135566949 |
| Molecular Formula | C12H21N5O8P2 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-[2-(6-oxo-1H-purin-9-yl)ethyl-(2-phosphonoethyl)amino]ethoxymethylphosphonic acid |
| SMILES | O=c1[nH]cnc2c1ncn2CCN(CCOCP(=O)(O)O)CCP(=O)(O)O |
| InChI | InChI=1S/C12H21N5O8P2/c18-12-10-11(13-7-14-12)17(8-15-10)2-1-16(4-6-26(19,20)21)3-5-25-9-27(22,23)24/h7-8H,1-6,9H2,(H,13,14,18)(H2,19,20,21)(H2,22,23,24) |
| InChIKey | DOQZRNUAQKXUPD-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 191.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|