C13H12ClN4O4P — CID 46844941
[4-[2-(6-chloropurin-9-yl)ethoxy]phenyl]phosphonic acid (PubChem CID 46844941) has the molecular formula C13H12ClN4O4P and a molecular weight of 354.69 g/mol. Its IUPAC name is [4-[2-(6-chloropurin-9-yl)ethoxy]phenyl]phosphonic acid.
| Compound Name | [4-[2-(6-chloropurin-9-yl)ethoxy]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 46844941 |
| Molecular Formula | C13H12ClN4O4P |
| Molecular Weight | 354.69 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | [4-[2-(6-chloropurin-9-yl)ethoxy]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc(OCCn2cnc3c(Cl)ncnc32)cc1 |
| InChI | InChI=1S/C13H12ClN4O4P/c14-12-11-13(16-7-15-12)18(8-17-11)5-6-22-9-1-3-10(4-2-9)23(19,20)21/h1-4,7-8H,5-6H2,(H2,19,20,21) |
| InChIKey | YMGQTNPLMOKYCO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.69 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|