C10H9ClF2N4 — CID 57168713
6-chloro-9-(5,5-difluoropent-4-enyl)purine (PubChem CID 57168713) has the molecular formula C10H9ClF2N4 and a molecular weight of 258.66 g/mol. Its IUPAC name is 6-chloro-9-(5,5-difluoropent-4-enyl)purine.
| Compound Name | 6-chloro-9-(5,5-difluoropent-4-enyl)purine |
|---|---|
| PubChem CID | 57168713 |
| Molecular Formula | C10H9ClF2N4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 6-chloro-9-(5,5-difluoropent-4-enyl)purine |
| SMILES | FC(F)=CCCCn1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C10H9ClF2N4/c11-9-8-10(15-5-14-9)17(6-16-8)4-2-1-3-7(12)13/h3,5-6H,1-2,4H2 |
| InChIKey | OKIFXYVUUYKUOY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|