C9H12N4O3 — CID 136653530
9-(3,4-dihydroxybutan-2-yl)-1H-purin-6-one (PubChem CID 136653530) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 9-(3,4-dihydroxybutan-2-yl)-1H-purin-6-one.
| Compound Name | 9-(3,4-dihydroxybutan-2-yl)-1H-purin-6-one |
|---|---|
| PubChem CID | 136653530 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 9-(3,4-dihydroxybutan-2-yl)-1H-purin-6-one |
| SMILES | CC(C(O)CO)n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C9H12N4O3/c1-5(6(15)2-14)13-4-12-7-8(13)10-3-11-9(7)16/h3-6,14-15H,2H2,1H3,(H,10,11,16) |
| InChIKey | OIUBMCJUWDDQIT-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |