C7H10N6O — CID 146555872
9-[amino(methylamino)methyl]-1H-purin-6-one (PubChem CID 146555872) has the molecular formula C7H10N6O and a molecular weight of 194.20 g/mol. Its IUPAC name is 9-[amino(methylamino)methyl]-1H-purin-6-one.
| Compound Name | 9-[amino(methylamino)methyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 146555872 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 9-[amino(methylamino)methyl]-1H-purin-6-one |
| SMILES | CNC(N)n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C7H10N6O/c1-9-7(8)13-3-12-4-5(13)10-2-11-6(4)14/h2-3,7,9H,8H2,1H3,(H,10,11,14) |
| InChIKey | NWRBMGDFZHIEKA-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|