C13H17F2N4O5P — CID 136870077
[difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate (PubChem CID 136870077) has the molecular formula C13H17F2N4O5P and a molecular weight of 378.27 g/mol. Its IUPAC name is [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate.
| Compound Name | [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate |
|---|---|
| PubChem CID | 136870077 |
| Molecular Formula | C13H17F2N4O5P |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate |
| SMILES | COP(=O)(OC)OC(F)(F)[C@H]1C[C@@H]1[C@H](C)n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C13H17F2N4O5P/c1-7(19-6-18-10-11(19)16-5-17-12(10)20)8-4-9(8)13(14,15)24-25(21,22-2)23-3/h5-9H,4H2,1-3H3,(H,16,17,20)/t7-,8+,9-/m0/s1 |
| InChIKey | ZFAVLHQLMSIMNE-YIZRAAEISA-N |
| XLogP | 2.33 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|