About [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate
[difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate (PubChem CID 136870077) has the molecular formula C13H17F2N4O5P
and a molecular weight of 378.27 g/mol. Its IUPAC name is [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate.
Molecular Properties
| Compound Name | [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate |
| PubChem CID | 136870077 |
| Molecular Formula | C13H17F2N4O5P |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate |
| SMILES | COP(=O)(OC)OC(F)(F)[C@H]1C[C@@H]1[C@H](C)n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C13H17F2N4O5P/c1-7(19-6-18-10-11(19)16-5-17-12(10)20)8-4-9(8)13(14,15)24-25(21,22-2)23-3/h5-9H,4H2,1-3H3,(H,16,17,20)/t7-,8+,9-/m0/s1 |
| InChIKey | ZFAVLHQLMSIMNE-YIZRAAEISA-N |
| XLogP | 2.33 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate?
The IUPAC name of [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate (CID 136870077) is [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate.
What is the SMILES notation for [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate?
The canonical SMILES for [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate is COP(=O)(OC)OC(F)(F)[C@H]1C[C@@H]1[C@H](C)n1cnc2c(=O)[nH]cnc21.
What is the InChIKey of [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate?
The InChIKey is ZFAVLHQLMSIMNE-YIZRAAEISA-N. The full InChI is InChI=1S/C13H17F2N4O5P/c1-7(19-6-18-10-11(19)16-5-17-12(10)20)8-4-9(8)13(14,15)24-25(21,22-2)23-3/h5-9H,4H2,1-3H3,(H,16,17,20)/t7-,8+,9-/m0/s1.
What are the key properties of [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate?
[difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate has a molecular weight of 378.27 g/mol, XLogP of 2.33, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [difluoro-[(1S,2S)-2-[(1S)-1-(6-oxo-1H-purin-9-yl)ethyl]cyclopropyl]methyl] dimethyl phosphate is sourced from PubChem (CID 136870077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).