C50H46FN5O4 — CID 135423420
9-[3-((18F)fluoromethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one (PubChem CID 135423420) has the molecular formula C50H46FN5O4 and a molecular weight of 798.95 g/mol. Its IUPAC name is 9-[3-((18F)fluoromethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one.
| Compound Name | 9-[3-((18F)fluoromethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 135423420 |
| Molecular Formula | C50H46FN5O4 |
| Molecular Weight | 798.95 g/mol |
| Exact Mass | 798.36 |
| IUPAC Name | 9-[3-((18F)fluoromethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
| SMILES | COc1ccc(C(Nc2nc3c(ncn3CCC(C[18F])COC(c3ccccc3)(c3ccccc3)c3ccc(OC)cc3)c(=O)[nH]2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C50H46FN5O4/c1-58-43-27-23-39(24-28-43)49(37-15-7-3-8-16-37,38-17-9-4-10-18-38)55-48-53-46-45(47(57)54-48)52-35-56(46)32-31-36(33-51)34-60-50(40-19-11-5-12-20-40,41-21-13-6-14-22-41)42-25-29-44(59-2)30-26-42/h3-30,35-36H,31-34H2,1-2H3,(H2,53,54,55,57)/i51-1 |
| InChIKey | GFKLKIZOZTWLFO-HANGLZGDSA-N |
| XLogP | 9.53 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.95 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|