C32H32FN5O5 — CID 174114286
9-[(2R,3S,4R)-3-fluoro-5,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one (PubChem CID 174114286) has the molecular formula C32H32FN5O5 and a molecular weight of 585.64 g/mol. Its IUPAC name is 9-[(2R,3S,4R)-3-fluoro-5,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,3S,4R)-3-fluoro-5,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 174114286 |
| Molecular Formula | C32H32FN5O5 |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 9-[(2R,3S,4R)-3-fluoro-5,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
| SMILES | COc1ccc(C(Nc2nc3c(ncn3[C@@H]3OC(CO)(CO)[C@@H](C)[C@@H]3F)c(=O)[nH]2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H32FN5O5/c1-20-25(33)29(43-31(20,17-39)18-40)38-19-34-26-27(38)35-30(36-28(26)41)37-32(21-9-5-3-6-10-21,22-11-7-4-8-12-22)23-13-15-24(42-2)16-14-23/h3-16,19-20,25,29,39-40H,17-18H2,1-2H3,(H2,35,36,37,41)/t20-,25-,29+/m0/s1 |
| InChIKey | PUCTYQSEYIIPKF-INOZPUMWSA-N |
| XLogP | 3.76 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|