C33H33N5O4 — CID 170213031
9-[(2R,4S,5S)-5-ethenyl-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one (PubChem CID 170213031) has the molecular formula C33H33N5O4 and a molecular weight of 563.66 g/mol. Its IUPAC name is 9-[(2R,4S,5S)-5-ethenyl-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5S)-5-ethenyl-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 170213031 |
| Molecular Formula | C33H33N5O4 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 9-[(2R,4S,5S)-5-ethenyl-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
| SMILES | C=C[C@]1(CO)O[C@@H](n2cnc3c(=O)[nH]c(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc32)C[C@@H]1C |
| InChI | InChI=1S/C33H33N5O4/c1-4-32(20-39)22(2)19-27(42-32)38-21-34-28-29(38)35-31(36-30(28)40)37-33(23-11-7-5-8-12-23,24-13-9-6-10-14-24)25-15-17-26(41-3)18-16-25/h4-18,21-22,27,39H,1,19-20H2,2-3H3,(H2,35,36,37,40)/t22-,27+,32+/m0/s1 |
| InChIKey | ZUDOKIGMAZYMTI-HKQDSUEQSA-N |
| XLogP | 5.00 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|