C31H27FN6O5 — CID 140610559
9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-5-isocyanooxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one (PubChem CID 140610559) has the molecular formula C31H27FN6O5 and a molecular weight of 582.59 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-5-isocyanooxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-5-isocyanooxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 140610559 |
| Molecular Formula | C31H27FN6O5 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-5-isocyanooxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
| SMILES | [C-]#[N+][C@]1(CO)O[C@@H](n2cnc3c(=O)[nH]c(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc32)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C31H27FN6O5/c1-33-30(17-39)25(40)23(32)28(43-30)38-18-34-24-26(38)35-29(36-27(24)41)37-31(19-9-5-3-6-10-19,20-11-7-4-8-12-20)21-13-15-22(42-2)16-14-21/h3-16,18,23,25,28,39-40H,17H2,2H3,(H2,35,36,37,41)/t23-,25+,28-,30-/m1/s1 |
| InChIKey | GERCVRBGVXTQOP-FXBJBQDLSA-N |
| XLogP | 3.37 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|