C31H27F2IN8O3 — CID 136932597
9-[(2R,4R,5S)-5-azido-3,3-difluoro-5-(iodomethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one (PubChem CID 136932597) has the molecular formula C31H27F2IN8O3 and a molecular weight of 724.51 g/mol. Its IUPAC name is 9-[(2R,4R,5S)-5-azido-3,3-difluoro-5-(iodomethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,4R,5S)-5-azido-3,3-difluoro-5-(iodomethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 136932597 |
| Molecular Formula | C31H27F2IN8O3 |
| Molecular Weight | 724.51 g/mol |
| Exact Mass | 724.12 |
| IUPAC Name | 9-[(2R,4R,5S)-5-azido-3,3-difluoro-5-(iodomethyl)-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
| SMILES | COc1ccc(C(Nc2nc3c(ncn3[C@@H]3O[C@@](CI)(N=[N+]=[N-])[C@@H](C)C3(F)F)c(=O)[nH]2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H27F2IN8O3/c1-19-29(17-34,40-41-35)45-27(31(19,32)33)42-18-36-24-25(42)37-28(38-26(24)43)39-30(20-9-5-3-6-10-20,21-11-7-4-8-12-21)22-13-15-23(44-2)16-14-22/h3-16,18-19,27H,17H2,1-2H3,(H2,37,38,39,43)/t19-,27-,29-/m1/s1 |
| InChIKey | HBONAPAWRLMJPD-NIRRXFOQSA-N |
| XLogP | 6.77 |
| TPSA | 142.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.51 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|