C48H43N5O5 — CID 162406854
9-[2-hydroxy-1-(1-hydroxy-3-trityloxypropan-2-yl)oxyethyl]-2-(tritylamino)-1H-purin-6-one (PubChem CID 162406854) has the molecular formula C48H43N5O5 and a molecular weight of 769.90 g/mol. Its IUPAC name is 9-[2-hydroxy-1-(1-hydroxy-3-trityloxypropan-2-yl)oxyethyl]-2-(tritylamino)-1H-purin-6-one.
| Compound Name | 9-[2-hydroxy-1-(1-hydroxy-3-trityloxypropan-2-yl)oxyethyl]-2-(tritylamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 162406854 |
| Molecular Formula | C48H43N5O5 |
| Molecular Weight | 769.90 g/mol |
| Exact Mass | 769.33 |
| IUPAC Name | 9-[2-hydroxy-1-(1-hydroxy-3-trityloxypropan-2-yl)oxyethyl]-2-(tritylamino)-1H-purin-6-one |
| SMILES | O=c1[nH]c(NC(c2ccccc2)(c2ccccc2)c2ccccc2)nc2c1ncn2C(CO)OC(CO)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H43N5O5/c54-31-41(33-57-48(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40)58-42(32-55)53-34-49-43-44(53)50-46(51-45(43)56)52-47(35-19-7-1-8-20-35,36-21-9-2-10-22-36)37-23-11-3-12-24-37/h1-30,34,41-42,54-55H,31-33H2,(H2,50,51,52,56) |
| InChIKey | YOXNVULCSQLBCR-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.90 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|