C47H41N5O3 — CID 135600907
9-(2-hydroxy-4-trityloxybutyl)-2-(tritylamino)-1H-purin-6-one (PubChem CID 135600907) has the molecular formula C47H41N5O3 and a molecular weight of 723.88 g/mol. Its IUPAC name is 9-(2-hydroxy-4-trityloxybutyl)-2-(tritylamino)-1H-purin-6-one.
| Compound Name | 9-(2-hydroxy-4-trityloxybutyl)-2-(tritylamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 135600907 |
| Molecular Formula | C47H41N5O3 |
| Molecular Weight | 723.88 g/mol |
| Exact Mass | 723.32 |
| IUPAC Name | 9-(2-hydroxy-4-trityloxybutyl)-2-(tritylamino)-1H-purin-6-one |
| SMILES | O=c1[nH]c(NC(c2ccccc2)(c2ccccc2)c2ccccc2)nc2c1ncn2CC(O)CCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H41N5O3/c53-41(31-32-55-47(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40)33-52-34-48-42-43(52)49-45(50-44(42)54)51-46(35-19-7-1-8-20-35,36-21-9-2-10-22-36)37-23-11-3-12-24-37/h1-30,34,41,53H,31-33H2,(H2,49,50,51,54) |
| InChIKey | DJPJSEVLTJSOHR-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.88 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|