C19H23N5O3 — CID 174183784
N-[9-(2-hydroxy-4-phenylbutyl)-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 174183784) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[9-(2-hydroxy-4-phenylbutyl)-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-(2-hydroxy-4-phenylbutyl)-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 174183784 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[9-(2-hydroxy-4-phenylbutyl)-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2CC(O)CCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H23N5O3/c1-12(2)17(26)22-19-21-16-15(18(27)23-19)20-11-24(16)10-14(25)9-8-13-6-4-3-5-7-13/h3-7,11-12,14,25H,8-10H2,1-2H3,(H2,21,22,23,26,27) |
| InChIKey | ZCJAESMUXWXRGQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |