C23H25N5O6 — CID 170586975
benzyl (2E)-2-[2-(hydroxymethyl)-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-ylidene]acetate (PubChem CID 170586975) has the molecular formula C23H25N5O6 and a molecular weight of 467.48 g/mol. Its IUPAC name is benzyl (2E)-2-[2-(hydroxymethyl)-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-ylidene]acetate.
| Compound Name | benzyl (2E)-2-[2-(hydroxymethyl)-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-ylidene]acetate |
|---|---|
| PubChem CID | 170586975 |
| Molecular Formula | C23H25N5O6 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | benzyl (2E)-2-[2-(hydroxymethyl)-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-ylidene]acetate |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2C2C/C(=C\C(=O)OCc3ccccc3)C(CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C23H25N5O6/c1-13(2)21(31)26-23-25-20-19(22(32)27-23)24-12-28(20)17-8-15(16(10-29)34-17)9-18(30)33-11-14-6-4-3-5-7-14/h3-7,9,12-13,16-17,29H,8,10-11H2,1-2H3,(H2,25,26,27,31,32)/b15-9+ |
| InChIKey | GBPAUNDLIDJQKN-OQLLNIDSSA-N |
| XLogP | 1.66 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|