C36H39N5O8 — CID 153293727
N-[9-[3-[bis(4-methoxyphenyl)-phenylmethoxy]-4,5-bis(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 153293727) has the molecular formula C36H39N5O8 and a molecular weight of 669.74 g/mol. Its IUPAC name is N-[9-[3-[bis(4-methoxyphenyl)-phenylmethoxy]-4,5-bis(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[3-[bis(4-methoxyphenyl)-phenylmethoxy]-4,5-bis(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 153293727 |
| Molecular Formula | C36H39N5O8 |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 669.28 |
| IUPAC Name | N-[9-[3-[bis(4-methoxyphenyl)-phenylmethoxy]-4,5-bis(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | COc1ccc(C(OC2C(CO)C(CO)OC2n2cnc3c(=O)[nH]c(NC(=O)C(C)C)nc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H39N5O8/c1-21(2)32(44)39-35-38-31-29(33(45)40-35)37-20-41(31)34-30(27(18-42)28(19-43)48-34)49-36(22-8-6-5-7-9-22,23-10-14-25(46-3)15-11-23)24-12-16-26(47-4)17-13-24/h5-17,20-21,27-28,30,34,42-43H,18-19H2,1-4H3,(H2,38,39,40,44,45) |
| InChIKey | ZZZQZDBLHMEKOH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|