C37H43N5O6 — CID 67084794
(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[1-[bis(4-methoxyphenyl)-phenylmethoxy]hexyl]-4-methoxyoxolan-3-ol (PubChem CID 67084794) has the molecular formula C37H43N5O6 and a molecular weight of 653.78 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[1-[bis(4-methoxyphenyl)-phenylmethoxy]hexyl]-4-methoxyoxolan-3-ol.
| Compound Name | (2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[1-[bis(4-methoxyphenyl)-phenylmethoxy]hexyl]-4-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 67084794 |
| Molecular Formula | C37H43N5O6 |
| Molecular Weight | 653.78 g/mol |
| Exact Mass | 653.32 |
| IUPAC Name | (2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[1-[bis(4-methoxyphenyl)-phenylmethoxy]hexyl]-4-methoxyoxolan-3-ol |
| SMILES | CCCCCC(OC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](OC)[C@@H]1O |
| InChI | InChI=1S/C37H43N5O6/c1-5-6-8-13-29(32-31(43)33(46-4)36(47-32)42-23-41-30-34(38)39-22-40-35(30)42)48-37(24-11-9-7-10-12-24,25-14-18-27(44-2)19-15-25)26-16-20-28(45-3)21-17-26/h7,9-12,14-23,29,31-33,36,43H,5-6,8,13H2,1-4H3,(H2,38,39,40)/t29?,31-,32-,33-,36-/m1/s1 |
| InChIKey | UEFHGUDSEDLHSW-SMMMVMJDSA-N |
| XLogP | 5.66 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.78 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|