C41H41N5O8 — CID 21356197
2-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(2-methoxyethoxy)oxolan-2-yl]-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-phenylethanone (PubChem CID 21356197) has the molecular formula C41H41N5O8 and a molecular weight of 731.81 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(2-methoxyethoxy)oxolan-2-yl]-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-phenylethanone.
| Compound Name | 2-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(2-methoxyethoxy)oxolan-2-yl]-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-phenylethanone |
|---|---|
| PubChem CID | 21356197 |
| Molecular Formula | C41H41N5O8 |
| Molecular Weight | 731.81 g/mol |
| Exact Mass | 731.30 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(2-methoxyethoxy)oxolan-2-yl]-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-phenylethanone |
| SMILES | COCCO[C@@H]1[C@H](O)[C@@H](C(OC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C(=O)c2ccccc2)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C41H41N5O8/c1-49-22-23-52-37-34(48)35(53-40(37)46-25-45-32-38(42)43-24-44-39(32)46)36(33(47)26-10-6-4-7-11-26)54-41(27-12-8-5-9-13-27,28-14-18-30(50-2)19-15-28)29-16-20-31(51-3)21-17-29/h4-21,24-25,34-37,40,48H,22-23H2,1-3H3,(H2,42,43,44)/t34-,35+,36?,37-,40-/m1/s1 |
| InChIKey | MKYJZNKRIPUVPU-KCUNIUSQSA-N |
| XLogP | 4.98 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.81 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|