C18H16ClN5O4 — CID 10201091
2-[[6-(4-chlorophenyl)-9-oxo-5H-imidazo[1,2-a]purin-3-yl]methoxy]ethyl acetate (PubChem CID 10201091) has the molecular formula C18H16ClN5O4 and a molecular weight of 401.81 g/mol. Its IUPAC name is 2-[[6-(4-chlorophenyl)-9-oxo-5H-imidazo[1,2-a]purin-3-yl]methoxy]ethyl acetate.
| Compound Name | 2-[[6-(4-chlorophenyl)-9-oxo-5H-imidazo[1,2-a]purin-3-yl]methoxy]ethyl acetate |
|---|---|
| PubChem CID | 10201091 |
| Molecular Formula | C18H16ClN5O4 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-[[6-(4-chlorophenyl)-9-oxo-5H-imidazo[1,2-a]purin-3-yl]methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCn1cnc2c(=O)n3cc(-c4ccc(Cl)cc4)[nH]c3nc21 |
| InChI | InChI=1S/C18H16ClN5O4/c1-11(25)28-7-6-27-10-23-9-20-15-16(23)22-18-21-14(8-24(18)17(15)26)12-2-4-13(19)5-3-12/h2-5,8-9H,6-7,10H2,1H3,(H,21,22) |
| InChIKey | NUPRBALXIJFOCR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|