C17H27N5O3Si — CID 11047082
3-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-methyl-5H-imidazo[1,2-a]purin-9-one (PubChem CID 11047082) has the molecular formula C17H27N5O3Si and a molecular weight of 377.52 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-methyl-5H-imidazo[1,2-a]purin-9-one.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-methyl-5H-imidazo[1,2-a]purin-9-one |
|---|---|
| PubChem CID | 11047082 |
| Molecular Formula | C17H27N5O3Si |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-methyl-5H-imidazo[1,2-a]purin-9-one |
| SMILES | Cc1cn2c(=O)c3ncn(COCCO[Si](C)(C)C(C)(C)C)c3nc2[nH]1 |
| InChI | InChI=1S/C17H27N5O3Si/c1-12-9-22-15(23)13-14(20-16(22)19-12)21(10-18-13)11-24-7-8-25-26(5,6)17(2,3)4/h9-10H,7-8,11H2,1-6H3,(H,19,20) |
| InChIKey | BAOFWJVNCAZHPD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|