C21H38N4O3Si2 — CID 11102421
1,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenylpurin-2-one (PubChem CID 11102421) has the molecular formula C21H38N4O3Si2 and a molecular weight of 450.73 g/mol. Its IUPAC name is 1,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenylpurin-2-one.
| Compound Name | 1,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenylpurin-2-one |
|---|---|
| PubChem CID | 11102421 |
| Molecular Formula | C21H38N4O3Si2 |
| Molecular Weight | 450.73 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenylpurin-2-one |
| SMILES | C=Cc1c2ncn(CO[Si](C)(C)C(C)(C)C)c2nc(=O)n1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38N4O3Si2/c1-12-16-17-18(24(13-22-17)14-27-29(8,9)20(2,3)4)23-19(26)25(16)15-28-30(10,11)21(5,6)7/h12-13H,1,14-15H2,2-11H3 |
| InChIKey | VEKXRRDJYYDPAL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.73 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|