C25H46N4O3Si2 — CID 11813168
1,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(4-methylpent-3-enyl)purin-2-one (PubChem CID 11813168) has the molecular formula C25H46N4O3Si2 and a molecular weight of 506.84 g/mol. Its IUPAC name is 1,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(4-methylpent-3-enyl)purin-2-one.
| Compound Name | 1,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(4-methylpent-3-enyl)purin-2-one |
|---|---|
| PubChem CID | 11813168 |
| Molecular Formula | C25H46N4O3Si2 |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 1,9-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(4-methylpent-3-enyl)purin-2-one |
| SMILES | CC(C)=CCCc1c2ncn(CO[Si](C)(C)C(C)(C)C)c2nc(=O)n1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46N4O3Si2/c1-19(2)14-13-15-20-21-22(28(16-26-21)17-31-33(9,10)24(3,4)5)27-23(30)29(20)18-32-34(11,12)25(6,7)8/h14,16H,13,15,17-18H2,1-12H3 |
| InChIKey | WPUSUCCOZWEDDS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|