C16H29N5O2Si — CID 10569967
4-[6-amino-9-[[tert-butyl(dimethyl)silyl]oxymethyl]purin-8-yl]butan-1-ol (PubChem CID 10569967) has the molecular formula C16H29N5O2Si and a molecular weight of 351.53 g/mol. Its IUPAC name is 4-[6-amino-9-[[tert-butyl(dimethyl)silyl]oxymethyl]purin-8-yl]butan-1-ol.
| Compound Name | 4-[6-amino-9-[[tert-butyl(dimethyl)silyl]oxymethyl]purin-8-yl]butan-1-ol |
|---|---|
| PubChem CID | 10569967 |
| Molecular Formula | C16H29N5O2Si |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 4-[6-amino-9-[[tert-butyl(dimethyl)silyl]oxymethyl]purin-8-yl]butan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCn1c(CCCCO)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H29N5O2Si/c1-16(2,3)24(4,5)23-11-21-12(8-6-7-9-22)20-13-14(17)18-10-19-15(13)21/h10,22H,6-9,11H2,1-5H3,(H2,17,18,19) |
| InChIKey | PRBBMPZQBBXYMY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|