C18H31N5O3Si — CID 66574369
(3S,4S,5S)-4-(6-aminopurin-9-yl)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]oxolan-3-ol (PubChem CID 66574369) has the molecular formula C18H31N5O3Si and a molecular weight of 393.56 g/mol. Its IUPAC name is (3S,4S,5S)-4-(6-aminopurin-9-yl)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]oxolan-3-ol.
| Compound Name | (3S,4S,5S)-4-(6-aminopurin-9-yl)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]oxolan-3-ol |
|---|---|
| PubChem CID | 66574369 |
| Molecular Formula | C18H31N5O3Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (3S,4S,5S)-4-(6-aminopurin-9-yl)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]oxolan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@H]1OC[C@@H](O)[C@@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C18H31N5O3Si/c1-18(2,3)27(4,5)26-8-6-7-13-15(12(24)9-25-13)23-11-22-14-16(19)20-10-21-17(14)23/h10-13,15,24H,6-9H2,1-5H3,(H2,19,20,21)/t12-,13+,15+/m1/s1 |
| InChIKey | SQCPAIFIBCAXLU-IPYPFGDCSA-N |
| XLogP | 2.51 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|