C20H34O2Si — CID 162786763
4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-one (PubChem CID 162786763) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-one.
| Compound Name | 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 162786763 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)=CCC1(CCCO[Si](C)(C)C(C)(C)C)C=CC(=O)C=C1 |
| InChI | InChI=1S/C20H34O2Si/c1-17(2)9-13-20(14-10-18(21)11-15-20)12-8-16-22-23(6,7)19(3,4)5/h9-11,14-15H,8,12-13,16H2,1-7H3 |
| InChIKey | DEQHVDAJAKZDGV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|