C17H24O3 — CID 11065696
3-(4-oxo-1-prop-2-enylcyclohexa-2,5-dien-1-yl)propyl 2,2-dimethylpropanoate (PubChem CID 11065696) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-(4-oxo-1-prop-2-enylcyclohexa-2,5-dien-1-yl)propyl 2,2-dimethylpropanoate.
| Compound Name | 3-(4-oxo-1-prop-2-enylcyclohexa-2,5-dien-1-yl)propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11065696 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 3-(4-oxo-1-prop-2-enylcyclohexa-2,5-dien-1-yl)propyl 2,2-dimethylpropanoate |
| SMILES | C=CCC1(CCCOC(=O)C(C)(C)C)C=CC(=O)C=C1 |
| InChI | InChI=1S/C17H24O3/c1-5-9-17(11-7-14(18)8-12-17)10-6-13-20-15(19)16(2,3)4/h5,7-8,11-12H,1,6,9-10,13H2,2-4H3 |
| InChIKey | JKFYMBFKAJLBFH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|