C13H25NO3 — CID 134504834
5-(1-hydroxyprop-2-enylamino)pentyl 2,2-dimethylpropanoate (PubChem CID 134504834) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 5-(1-hydroxyprop-2-enylamino)pentyl 2,2-dimethylpropanoate.
| Compound Name | 5-(1-hydroxyprop-2-enylamino)pentyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134504834 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 5-(1-hydroxyprop-2-enylamino)pentyl 2,2-dimethylpropanoate |
| SMILES | C=CC(O)NCCCCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H25NO3/c1-5-11(15)14-9-7-6-8-10-17-12(16)13(2,3)4/h5,11,14-15H,1,6-10H2,2-4H3 |
| InChIKey | BTPQLGAELKOOJZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|