About [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate
[(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate (PubChem CID 178184690) has the molecular formula C17H29ClO4
and a molecular weight of 332.87 g/mol. Its IUPAC name is [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate |
| PubChem CID | 178184690 |
| Molecular Formula | C17H29ClO4 |
| Molecular Weight | 332.87 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CCCC[C@@H](Cl)[C@@H](O)CC(=O)CCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H29ClO4/c1-5-6-7-10-14(18)15(20)12-13(19)9-8-11-22-16(21)17(2,3)4/h5,14-15,20H,1,6-12H2,2-4H3/t14-,15+/m1/s1 |
| InChIKey | SFAGHSJVYBAODX-CABCVRRESA-N |
| XLogP | 3.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.87 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate?
The IUPAC name of [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate (CID 178184690) is [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate?
The canonical SMILES for [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate is C=CCCC[C@@H](Cl)[C@@H](O)CC(=O)CCCOC(=O)C(C)(C)C.
What is the InChIKey of [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate?
The InChIKey is SFAGHSJVYBAODX-CABCVRRESA-N. The full InChI is InChI=1S/C17H29ClO4/c1-5-6-7-10-14(18)15(20)12-13(19)9-8-11-22-16(21)17(2,3)4/h5,14-15,20H,1,6-12H2,2-4H3/t14-,15+/m1/s1.
What are the key properties of [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate?
[(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate has a molecular weight of 332.87 g/mol, XLogP of 3.64, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S,7R)-7-chloro-6-hydroxy-4-oxododec-11-enyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 178184690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).