C25H37NO4Si — CID 54754439
2-[(1Z)-1-[tert-butyl(dimethyl)silyl]oxy-9-methyldeca-1,8-dien-5-yl]oxyisoindole-1,3-dione (PubChem CID 54754439) has the molecular formula C25H37NO4Si and a molecular weight of 443.66 g/mol. Its IUPAC name is 2-[(1Z)-1-[tert-butyl(dimethyl)silyl]oxy-9-methyldeca-1,8-dien-5-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-[(1Z)-1-[tert-butyl(dimethyl)silyl]oxy-9-methyldeca-1,8-dien-5-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 54754439 |
| Molecular Formula | C25H37NO4Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 2-[(1Z)-1-[tert-butyl(dimethyl)silyl]oxy-9-methyldeca-1,8-dien-5-yl]oxyisoindole-1,3-dione |
| SMILES | CC(C)=CCCC(CC/C=C\O[Si](C)(C)C(C)(C)C)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H37NO4Si/c1-19(2)13-12-15-20(14-10-11-18-29-31(6,7)25(3,4)5)30-26-23(27)21-16-8-9-17-22(21)24(26)28/h8-9,11,13,16-18,20H,10,12,14-15H2,1-7H3/b18-11- |
| InChIKey | DUYLZXKPBIKQMV-WQRHYEAKSA-N |
| XLogP | 6.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|