C21H29NO3 — CID 72701710
2-tridec-1-en-4-yloxyisoindole-1,3-dione (PubChem CID 72701710) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-tridec-1-en-4-yloxyisoindole-1,3-dione.
| Compound Name | 2-tridec-1-en-4-yloxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 72701710 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-tridec-1-en-4-yloxyisoindole-1,3-dione |
| SMILES | C=CCC(CCCCCCCCC)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H29NO3/c1-3-5-6-7-8-9-10-14-17(13-4-2)25-22-20(23)18-15-11-12-16-19(18)21(22)24/h4,11-12,15-17H,2-3,5-10,13-14H2,1H3 |
| InChIKey | JLVNIWNALYTGOW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|