C24H31NO4 — CID 101263871
2-[(E)-1-(2-methyl-4-prop-2-enyloxolan-3-yl)oct-1-en-3-yl]oxyisoindole-1,3-dione (PubChem CID 101263871) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[(E)-1-(2-methyl-4-prop-2-enyloxolan-3-yl)oct-1-en-3-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-[(E)-1-(2-methyl-4-prop-2-enyloxolan-3-yl)oct-1-en-3-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 101263871 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-[(E)-1-(2-methyl-4-prop-2-enyloxolan-3-yl)oct-1-en-3-yl]oxyisoindole-1,3-dione |
| SMILES | C=CCC1COC(C)C1/C=C/C(CCCCC)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H31NO4/c1-4-6-7-11-19(14-15-20-17(3)28-16-18(20)10-5-2)29-25-23(26)21-12-8-9-13-22(21)24(25)27/h5,8-9,12-15,17-20H,2,4,6-7,10-11,16H2,1,3H3/b15-14+ |
| InChIKey | ZZAMJJQBXUSCSC-CCEZHUSRSA-N |
| XLogP | 4.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|