C18H23NO5 — CID 129308444
(1,3-dioxoisoindol-2-yl) 2-octan-2-yloxyacetate (PubChem CID 129308444) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2-octan-2-yloxyacetate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 2-octan-2-yloxyacetate |
|---|---|
| PubChem CID | 129308444 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2-octan-2-yloxyacetate |
| SMILES | CCCCCCC(C)OCC(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H23NO5/c1-3-4-5-6-9-13(2)23-12-16(20)24-19-17(21)14-10-7-8-11-15(14)18(19)22/h7-8,10-11,13H,3-6,9,12H2,1-2H3 |
| InChIKey | NCPWRRMELFOWTE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|