C18H15NO5 — CID 132786913
(1,3-dioxoisoindol-2-yl) 2-(2,6-dimethylphenoxy)acetate (PubChem CID 132786913) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2-(2,6-dimethylphenoxy)acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 2-(2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 132786913 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2-(2,6-dimethylphenoxy)acetate |
| SMILES | Cc1cccc(C)c1OCC(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H15NO5/c1-11-6-5-7-12(2)16(11)23-10-15(20)24-19-17(21)13-8-3-4-9-14(13)18(19)22/h3-9H,10H2,1-2H3 |
| InChIKey | DANFBOLXCMAKAD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|