C10H6N3O4+ — CID 170920036
2-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethanediazonium (PubChem CID 170920036) has the molecular formula C10H6N3O4+ and a molecular weight of 232.18 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethanediazonium.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethanediazonium |
|---|---|
| PubChem CID | 170920036 |
| Molecular Formula | C10H6N3O4+ |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethanediazonium |
| SMILES | N#[N+]CC(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H6N3O4/c11-12-5-8(14)17-13-9(15)6-3-1-2-4-7(6)10(13)16/h1-4H,5H2/q+1 |
| InChIKey | SCLIJYCZOIQLQE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|