C13H12ClNO4 — CID 164510784
(1,3-dioxoisoindol-2-yl) 3-chloro-2,2-dimethylpropanoate (PubChem CID 164510784) has the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 3-chloro-2,2-dimethylpropanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 3-chloro-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 164510784 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 3-chloro-2,2-dimethylpropanoate |
| SMILES | CC(C)(CCl)C(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H12ClNO4/c1-13(2,7-14)12(18)19-15-10(16)8-5-3-4-6-9(8)11(15)17/h3-6H,7H2,1-2H3 |
| InChIKey | HLUZRWSAKOTDAO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|