C20H27NO4 — CID 123863839
(1,3-dioxoisoindol-2-yl) 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123863839) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123863839 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)ON1C(=O)c2ccccc2C1=O)C(C)(C)C |
| InChI | InChI=1S/C20H27NO4/c1-18(2,3)12-20(7,19(4,5)6)17(24)25-21-15(22)13-10-8-9-11-14(13)16(21)23/h8-11H,12H2,1-7H3 |
| InChIKey | UXLKPNLAROIJSQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|