C13H10BrNO5 — CID 72793355
2-(3-bromo-2,4-dioxopentan-3-yl)oxyisoindole-1,3-dione (PubChem CID 72793355) has the molecular formula C13H10BrNO5 and a molecular weight of 340.13 g/mol. Its IUPAC name is 2-(3-bromo-2,4-dioxopentan-3-yl)oxyisoindole-1,3-dione.
| Compound Name | 2-(3-bromo-2,4-dioxopentan-3-yl)oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 72793355 |
| Molecular Formula | C13H10BrNO5 |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 2-(3-bromo-2,4-dioxopentan-3-yl)oxyisoindole-1,3-dione |
| SMILES | CC(=O)C(Br)(ON1C(=O)c2ccccc2C1=O)C(C)=O |
| InChI | InChI=1S/C13H10BrNO5/c1-7(16)13(14,8(2)17)20-15-11(18)9-5-3-4-6-10(9)12(15)19/h3-6H,1-2H3 |
| InChIKey | ZUROKHXVATZFDK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|