C10H6BrNO4 — CID 177183657
(5-bromo-1,3-dioxoisoindol-2-yl) acetate (PubChem CID 177183657) has the molecular formula C10H6BrNO4 and a molecular weight of 284.06 g/mol. Its IUPAC name is (5-bromo-1,3-dioxoisoindol-2-yl) acetate.
| Compound Name | (5-bromo-1,3-dioxoisoindol-2-yl) acetate |
|---|---|
| PubChem CID | 177183657 |
| Molecular Formula | C10H6BrNO4 |
| Molecular Weight | 284.06 g/mol |
| Exact Mass | 282.95 |
| IUPAC Name | (5-bromo-1,3-dioxoisoindol-2-yl) acetate |
| SMILES | CC(=O)ON1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C10H6BrNO4/c1-5(13)16-12-9(14)7-3-2-6(11)4-8(7)10(12)15/h2-4H,1H3 |
| InChIKey | XXXJVORYWCINFP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.06 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|