C14H14BrNO4 — CID 67305870
methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 67305870) has the molecular formula C14H14BrNO4 and a molecular weight of 340.17 g/mol. Its IUPAC name is methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 67305870 |
| Molecular Formula | C14H14BrNO4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | COC(=O)C(C(C)C)N1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C14H14BrNO4/c1-7(2)11(14(19)20-3)16-12(17)9-5-4-8(15)6-10(9)13(16)18/h4-7,11H,1-3H3 |
| InChIKey | OPELUUIOVCRRPB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|