methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate

C14H14BrNO4 — CID 67305870

IUPACmethyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate
SMILESCOC(=O)C(C(C)C)N1C(=O)c2ccc(Br)cc2C1=O
InChIInChI=1S/C14H14BrNO4/c1-7(2)11(14(19)20-3)16-12(17)9-5-4-8(15)6-10(9)13(16)18/h4-7,11H,1-3H3
InChIKeyOPELUUIOVCRRPB-UHFFFAOYSA-N
MW340.17 g/mol
LogP2.24
Rot. Bonds3

About methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate

methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 67305870) has the molecular formula C14H14BrNO4 and a molecular weight of 340.17 g/mol. Its IUPAC name is methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate.

Molecular Properties

Compound Namemethyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate
PubChem CID67305870
Molecular FormulaC14H14BrNO4
Molecular Weight340.17 g/mol
Exact Mass339.01
IUPAC Namemethyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate
SMILESCOC(=O)C(C(C)C)N1C(=O)c2ccc(Br)cc2C1=O
InChIInChI=1S/C14H14BrNO4/c1-7(2)11(14(19)20-3)16-12(17)9-5-4-8(15)6-10(9)13(16)18/h4-7,11H,1-3H3
InChIKeyOPELUUIOVCRRPB-UHFFFAOYSA-N
XLogP2.24
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.17
LogP ≤ 52.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate?
The IUPAC name of methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate (CID 67305870) is methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
What is the SMILES notation for methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate?
The canonical SMILES for methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate is COC(=O)C(C(C)C)N1C(=O)c2ccc(Br)cc2C1=O.
What is the InChIKey of methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate?
The InChIKey is OPELUUIOVCRRPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrNO4/c1-7(2)11(14(19)20-3)16-12(17)9-5-4-8(15)6-10(9)13(16)18/h4-7,11H,1-3H3.
What are the key properties of methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate?
methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate has a molecular weight of 340.17 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-bromo-1,3-dioxoisoindol-2-yl)-3-methylbutanoate is sourced from PubChem (CID 67305870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).