C11H15NO4 — CID 60975925
methyl 3-methyl-2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 60975925) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is methyl 3-methyl-2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | methyl 3-methyl-2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 60975925 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl 3-methyl-2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | COC(=O)C(C(C)C)N1C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C11H15NO4/c1-6(2)9(11(15)16-4)12-8(13)5-7(3)10(12)14/h5-6,9H,1-4H3 |
| InChIKey | QRCNBNINCMYICJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|