C10H11NO6 — CID 22403510
2-(3-methyl-2,5-dioxopyrrol-1-yl)pentanedioic acid (PubChem CID 22403510) has the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxopyrrol-1-yl)pentanedioic acid.
| Compound Name | 2-(3-methyl-2,5-dioxopyrrol-1-yl)pentanedioic acid |
|---|---|
| PubChem CID | 22403510 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-(3-methyl-2,5-dioxopyrrol-1-yl)pentanedioic acid |
| SMILES | CC1=CC(=O)N(C(CCC(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C10H11NO6/c1-5-4-7(12)11(9(5)15)6(10(16)17)2-3-8(13)14/h4,6H,2-3H2,1H3,(H,13,14)(H,16,17) |
| InChIKey | LMZGHECZMHGXBC-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|