C24H34N2O8Zn — CID 162224354
bis(7-(3-methyl-2,5-dioxopyrrol-1-yl)heptanoic acid);zinc (PubChem CID 162224354) has the molecular formula C24H34N2O8Zn and a molecular weight of 543.93 g/mol. Its IUPAC name is bis(7-(3-methyl-2,5-dioxopyrrol-1-yl)heptanoic acid);zinc.
| Compound Name | bis(7-(3-methyl-2,5-dioxopyrrol-1-yl)heptanoic acid);zinc |
|---|---|
| PubChem CID | 162224354 |
| Molecular Formula | C24H34N2O8Zn |
| Molecular Weight | 543.93 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | bis(7-(3-methyl-2,5-dioxopyrrol-1-yl)heptanoic acid);zinc |
| SMILES | CC1=CC(=O)N(CCCCCCC(=O)O)C1=O.CC1=CC(=O)N(CCCCCCC(=O)O)C1=O.[Zn] |
| InChI | InChI=1S/2C12H17NO4.Zn/c2*1-9-8-10(14)13(12(9)17)7-5-3-2-4-6-11(15)16;/h2*8H,2-7H2,1H3,(H,15,16); |
| InChIKey | ZUNYVVZABULDBM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.93 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|