About 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine
6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine (PubChem CID 67842870) has the molecular formula C20H28N2O4
and a molecular weight of 360.45 g/mol. Its IUPAC name is 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine.
Molecular Properties
| Compound Name | 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine |
| PubChem CID | 67842870 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine |
| SMILES | CC(CN)c1ccccc1.CC1=CC(=O)N(CCCCCC(=O)O)C1=O |
| InChI | InChI=1S/C11H15NO4.C9H13N/c1-8-7-9(13)12(11(8)16)6-4-2-3-5-10(14)15;1-8(7-10)9-5-3-2-4-6-9/h7H,2-6H2,1H3,(H,14,15);2-6,8H,7,10H2,1H3 |
| InChIKey | ZGOFLYAULIHBSF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine?
The IUPAC name of 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine (CID 67842870) is 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine.
What is the SMILES notation for 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine?
The canonical SMILES for 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine is CC(CN)c1ccccc1.CC1=CC(=O)N(CCCCCC(=O)O)C1=O.
What is the InChIKey of 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine?
The InChIKey is ZGOFLYAULIHBSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4.C9H13N/c1-8-7-9(13)12(11(8)16)6-4-2-3-5-10(14)15;1-8(7-10)9-5-3-2-4-6-9/h7H,2-6H2,1H3,(H,14,15);2-6,8H,7,10H2,1H3.
What are the key properties of 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine?
6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine has a molecular weight of 360.45 g/mol, XLogP of 2.70, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid;2-phenylpropan-1-amine is sourced from PubChem (CID 67842870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).