About 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate
3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate (PubChem CID 57098739) has the molecular formula C18H21NO6
and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate.
Molecular Properties
| Compound Name | 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate |
| PubChem CID | 57098739 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate |
| SMILES | CC1=CC(=O)N(CCCOC(=O)OOC(C)(C)c2ccccc2)C1=O |
| InChI | InChI=1S/C18H21NO6/c1-13-12-15(20)19(16(13)21)10-7-11-23-17(22)24-25-18(2,3)14-8-5-4-6-9-14/h4-6,8-9,12H,7,10-11H2,1-3H3 |
| InChIKey | VYXBOSDXBVHPKM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate?
The IUPAC name of 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate (CID 57098739) is 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate.
What is the SMILES notation for 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate?
The canonical SMILES for 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate is CC1=CC(=O)N(CCCOC(=O)OOC(C)(C)c2ccccc2)C1=O.
What is the InChIKey of 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate?
The InChIKey is VYXBOSDXBVHPKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO6/c1-13-12-15(20)19(16(13)21)10-7-11-23-17(22)24-25-18(2,3)14-8-5-4-6-9-14/h4-6,8-9,12H,7,10-11H2,1-3H3.
What are the key properties of 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate?
3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate has a molecular weight of 347.37 g/mol, XLogP of 2.71, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl 2-phenylpropan-2-yloxy carbonate is sourced from PubChem (CID 57098739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).