C20H35NO6 — CID 57198051
1-[4,4-bis(2-methylbutan-2-ylperoxy)pentyl]-3-methylpyrrole-2,5-dione (PubChem CID 57198051) has the molecular formula C20H35NO6 and a molecular weight of 385.50 g/mol. Its IUPAC name is 1-[4,4-bis(2-methylbutan-2-ylperoxy)pentyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[4,4-bis(2-methylbutan-2-ylperoxy)pentyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 57198051 |
| Molecular Formula | C20H35NO6 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 1-[4,4-bis(2-methylbutan-2-ylperoxy)pentyl]-3-methylpyrrole-2,5-dione |
| SMILES | CCC(C)(C)OOC(C)(CCCN1C(=O)C=C(C)C1=O)OOC(C)(C)CC |
| InChI | InChI=1S/C20H35NO6/c1-9-18(4,5)24-26-20(8,27-25-19(6,7)10-2)12-11-13-21-16(22)14-15(3)17(21)23/h14H,9-13H2,1-8H3 |
| InChIKey | ARTYKDICPPKOBH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|