C14H15N2O4+ — CID 163231405
3-methyl-1-[4-(3-methyl-2,5-dioxopyrrol-1-ium-1-ylidene)butyl]pyrrole-2,5-dione (PubChem CID 163231405) has the molecular formula C14H15N2O4+ and a molecular weight of 275.28 g/mol. Its IUPAC name is 3-methyl-1-[4-(3-methyl-2,5-dioxopyrrol-1-ium-1-ylidene)butyl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[4-(3-methyl-2,5-dioxopyrrol-1-ium-1-ylidene)butyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 163231405 |
| Molecular Formula | C14H15N2O4+ |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3-methyl-1-[4-(3-methyl-2,5-dioxopyrrol-1-ium-1-ylidene)butyl]pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(CCC/C=[N+]2\C(=O)C=C(C)C2=O)C1=O |
| InChI | InChI=1S/C14H15N2O4/c1-9-7-11(17)15(13(9)19)5-3-4-6-16-12(18)8-10(2)14(16)20/h5,7-8H,3-4,6H2,1-2H3/q+1/b15-5+ |
| InChIKey | SVXOIVIHZPXWTK-PJQLUOCWSA-N |
| XLogP | 0.18 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|