C14H28N2O2Si2 — CID 67080004
1-[3-[bis(trimethylsilyl)amino]propyl]-3-methylpyrrole-2,5-dione (PubChem CID 67080004) has the molecular formula C14H28N2O2Si2 and a molecular weight of 312.56 g/mol. Its IUPAC name is 1-[3-[bis(trimethylsilyl)amino]propyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[3-[bis(trimethylsilyl)amino]propyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 67080004 |
| Molecular Formula | C14H28N2O2Si2 |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[3-[bis(trimethylsilyl)amino]propyl]-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(CCCN([Si](C)(C)C)[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C14H28N2O2Si2/c1-12-11-13(17)15(14(12)18)9-8-10-16(19(2,3)4)20(5,6)7/h11H,8-10H2,1-7H3 |
| InChIKey | GDEVPFHZDYCOGL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|